Difference between revisions of "CYTOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18681 == * transcription-direction: ** negative * right-end-position: ** 146810 * left-end-position: ** 128060 * centisome-position: ** 53.56389...")
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18681 ==
+
== Metabolite SUC-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** succinyl-coa
* right-end-position:
+
* smiles:
** 146810
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 128060
+
** vnoyujkhfwywir-itiydsspsa-i
* centisome-position:
+
* molecular-weight:
** 53.56389   
+
** 862.568
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[AKGDHe2r]]
== Reaction(s) associated ==
+
* [[HOMSUCTRAN-RXN]]
* [[RXN-15556]]
+
* [[RXN0-1147]]
** Category: [[annotation]]
+
* [[SUCCCOASYN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2OXOGLUTARATEDEH-RXN]]
== Pathway(s) associated ==
+
* [[AKGDHe2r]]
* [[PWY-7511]]
+
* [[RXN0-1147]]
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[SUCCCOASYN-RXN]]
{{#set: transcription-direction=negative}}
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
{{#set: right-end-position=146810}}
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
{{#set: left-end-position=128060}}
+
== Reaction(s) of unknown directionality ==
{{#set: centisome-position=53.56389    }}
+
{{#set: common-name=succinyl-coa}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
{{#set: nb reaction associated=2}}
+
{{#set: molecular-weight=862.568}}
{{#set: nb pathway associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite SUC-COA

  • common-name:
    • succinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vnoyujkhfwywir-itiydsspsa-i
  • molecular-weight:
    • 862.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality