Difference between revisions of "Protein-tauphospho-L-histidines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIENOYLCOAREDUCT-RXN DIENOYLCOAREDUCT-RXN] == * direction: ** left-to-right * common-name: ** 2,4-d...")
(Created page with "Category:metabolite == Metabolite CPD-321 == * common-name: ** 3-aci-nitropropanoate * smiles: ** c(cc([o-])=o)=[n+]([o-])[o-] * inchi-key: ** kxxxivrxvxkxpa-uhfffaoysa-m...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIENOYLCOAREDUCT-RXN DIENOYLCOAREDUCT-RXN] ==
+
== Metabolite CPD-321 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 2,4-dienoyl-coa reductase
+
** 3-aci-nitropropanoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.34 ec-1.3.1.34]
+
** c(cc([o-])=o)=[n+]([o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[T2-C4-DECADIENYL-COA]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[T2-DECENOYL-COA]][c]
+
** kxxxivrxvxkxpa-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18892]]
+
** 117.061
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-16322]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=3-aci-nitropropanoate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=kxxxivrxvxkxpa-uhfffaoysa-m}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=117.061}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q16698 Q16698]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=2,4-dienoyl-coa reductase}}
 
−
{{#set: ec-number=ec-1.3.1.34}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-321

  • common-name:
    • 3-aci-nitropropanoate
  • smiles:
    • c(cc([o-])=o)=[n+]([o-])[o-]
  • inchi-key:
    • kxxxivrxvxkxpa-uhfffaoysa-m
  • molecular-weight:
    • 117.061

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Protein-tauphospho-L-histidines&oldid=47337"