Difference between revisions of "CPD1F-90"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_LPAREN_3h_RPAREN_tm ATP_LPAREN_3h_RPAREN_tm] == * direction: ** left-to-right * common-name: **...") |
(Created page with "Category:metabolite == Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE == * common-name: ** 15-dehydro-prostaglandin e2 * smiles: ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 15-dehydro-prostaglandin e2 |
− | + | * smiles: | |
− | * | + | ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) |
− | = | + | * inchi-key: |
− | * | + | ** yrtjdwrobkpznv-kmxmbppjsa-m |
− | ** | + | * molecular-weight: |
− | ** | + | ** 349.446 |
− | == | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[1.1.1.141-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[1.1.1.141-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=15-dehydro-prostaglandin e2}} |
− | + | {{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=349.446}} |
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE
- common-name:
- 15-dehydro-prostaglandin e2
- smiles:
- cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
- inchi-key:
- yrtjdwrobkpznv-kmxmbppjsa-m
- molecular-weight:
- 349.446