|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9680 RXN-9680] == | + | == Metabolite CPD1F-90 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** dimethylglycine-betaine methyltransferase | + | ** kaempferol |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.1.1.161 ec-2.1.1.161] | + | ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3) |
| − | * synonymous:
| + | * inchi-key: |
| − | ** apdmt
| + | ** iyrmwmyzsqpjkc-uhfffaoysa-m |
| − | ** gsdmt
| + | * molecular-weight: |
| − | ** sarcosine-dimethylglycine methyltransferase
| + | ** 285.232 |
| − | ** s-adenosyl-l-methionine:n,n-dimethylglycine n-methyltransferase
| + | == Reaction(s) known to consume the compound == |
| − | ** sarcosine dimethylglycine n-methyltransferase
| + | * [[RXN-12510]] |
| − | ** glycine sarcosine dimethylglycine n-methyltransferase
| + | * [[RXN-13935]] |
| − | ** sdmt
| + | * [[RXN1F-461]] |
| − | == Reaction formula == | + | == Reaction(s) known to produce the compound == |
| − | * 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[BETAINE]][c] '''+''' 1 [[PROTON]][c]
| + | * [[RXN1F-93]] |
| − | == Gene(s) associated with this reaction == | + | == Reaction(s) of unknown directionality == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | {{#set: common-name=kaempferol}} |
| − | * Gene: [[SJ12118]]
| + | {{#set: inchi-key=inchikey=iyrmwmyzsqpjkc-uhfffaoysa-m}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=285.232}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ10116]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12128]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12119]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ11087]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ14716]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ18177]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12116]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ03081]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ02539]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ02540]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[P541-PWY]], glycine betaine biosynthesis IV (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=P541-PWY P541-PWY] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6004]], glycine betaine biosynthesis V (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6004 PWY-6004]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links ==
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10073 10073]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R07244 R07244]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=dimethylglycine-betaine methyltransferase}} | |
| − | {{#set: ec-number=ec-2.1.1.161}} | |
| − | {{#set: synonymous=glycine sarcosine dimethylglycine n-methyltransferase|sdmt|sarcosine-dimethylglycine methyltransferase|gsdmt|apdmt|sarcosine dimethylglycine n-methyltransferase|s-adenosyl-l-methionine:n,n-dimethylglycine n-methyltransferase}}
| |
| − | {{#set: nb gene associated=11}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
