Difference between revisions of "CPD-9873"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** left-to-right * common-name: ** (2e)-5-methylhexa-2,4-dieno...")
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] ==
+
== Metabolite CPD-14123 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** (2e)-5-methylhexa-2,4-dienoyl-coa hydratase
+
** 3-amino-2,3-dideoxy-scyllo-inosose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1 ec-4.2.1]
+
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12904]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-12905]][c]
+
** fsugckmutgkwie-ygivhsipsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03913]]
+
** 162.165
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-13118]]
−
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=162.165}}
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08093 R08093]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa hydratase}}
 
−
{{#set: ec-number=ec-4.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-14123

  • common-name:
    • 3-amino-2,3-dideoxy-scyllo-inosose
  • smiles:
    • c1(c([n+])c(o)c(o)c(o)c(=o)1)
  • inchi-key:
    • fsugckmutgkwie-ygivhsipsa-o
  • molecular-weight:
    • 162.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9873&oldid=47398"