Difference between revisions of "CPD-15690"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08226 == * transcription-direction: ** negative * right-end-position: ** 28845 * left-end-position: ** 6355 * centisome-position: ** 11.28013 =...")
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ08226 ==
+
== Metabolite 3-SULFINOALANINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-sulfinoalanine
−
* right-end-position:
+
* smiles:
−
** 28845
+
** c(c([n+])c(=o)[o-])s([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 6355
+
** advptqaunprnpo-reohclbhsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 11.28013   
+
** 152.145
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
* [[2.7.11.7-RXN]]
+
* [[CYSTEINE-DIOXYGENASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-sulfinoalanine}}
−
* [[ATPASE-RXN]]
+
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=152.145}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=28845}}
 
−
{{#set: left-end-position=6355}}
 
−
{{#set: centisome-position=11.28013    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:35, 18 December 2020

Metabolite 3-SULFINOALANINE

  • common-name:
    • 3-sulfinoalanine
  • smiles:
    • c(c([n+])c(=o)[o-])s([o-])=o
  • inchi-key:
    • advptqaunprnpo-reohclbhsa-m
  • molecular-weight:
    • 152.145

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15690&oldid=47413"