Difference between revisions of "CPD-18733"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07152 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GALACTOSIDE-2-L-FUCOSYLT...") |
(Created page with "Category:metabolite == Metabolite CPD-15690 == * common-name: ** (3r)-hydroxy-5-trans-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15690 == |
− | == | + | * common-name: |
− | + | ** (3r)-hydroxy-5-trans-dodecenoyl-coa | |
− | = | + | * smiles: |
− | + | ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** ayordfmyybnsbo-gkmlisqesa-j |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 959.791 |
− | + | == Reaction(s) known to consume the compound == | |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[RXN-14801]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
+ | {{#set: common-name=(3r)-hydroxy-5-trans-dodecenoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=ayordfmyybnsbo-gkmlisqesa-j}} | ||
+ | {{#set: molecular-weight=959.791}} |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-15690
- common-name:
- (3r)-hydroxy-5-trans-dodecenoyl-coa
- smiles:
- ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ayordfmyybnsbo-gkmlisqesa-j
- molecular-weight:
- 959.791