|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1623 RXN-1623] == | + | == Metabolite MALTOTETRAOSE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** acyl-coa:1-acyl-sn-glycerol-3-phosphate 2-o-acyltransferase | + | ** maltotetraose |
| − | ** 1-acylglycerol-3-phosphate o-acyltransferase | + | * smiles: |
| − | * ec-number:
| + | ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.51 ec-2.3.1.51] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** luewuzlmquobsb-ayqjavfrsa-n |
| − | * 1 [[ACYL-COA]][c] '''+''' 1 [[ACYL-SN-GLYCEROL-3P]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[L-PHOSPHATIDATE]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 666.583 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ01857]]
| + | * [[RXN0-5182]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[GLYMALTOPHOSPHORYL-RXN]] |
| − | ** Category: [[orthology]] | + | * [[RXN-14281]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-14284]] |
| − | * Gene: [[SJ13801]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=maltotetraose}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=666.583}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ13643]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ18009]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ15136]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ10647]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ13501]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ20565]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ09888]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ08831]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] | |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-5667]], CDP-diacylglycerol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667] | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19710 19710]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02241 R02241]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=acyl-coa:1-acyl-sn-glycerol-3-phosphate 2-o-acyltransferase|1-acylglycerol-3-phosphate o-acyltransferase}} | |
| − | {{#set: ec-number=ec-2.3.1.51}} | |
| − | {{#set: nb gene associated=10}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
