Difference between revisions of "2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOLOCYTOCHROME-C-SYNTHASE-RXN HOLOCYTOCHROME-C-SYNTHASE-RXN] == * direction: ** reversible * ec-num...") |
(Created page with "Category:metabolite == Metabolite CPD-17814 == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17814 == |
− | * | + | * common-name: |
− | ** | + | ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o |
− | == | + | * inchi-key: |
− | + | ** shgdvnglfxviak-bfvorphasa-j | |
− | = | + | * molecular-weight: |
− | + | ** 1015.898 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-16559]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-16558]] |
− | + | * [[RXN-16559]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(11z)-(s)-3-hydroxyhexadec-11-enoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=shgdvnglfxviak-bfvorphasa-j}} | |
− | ** | + | {{#set: molecular-weight=1015.898}} |
− | == | ||
− | |||
− | * | ||
− | |||
− | == | ||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-17814
- common-name:
- (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
- smiles:
- ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
- inchi-key:
- shgdvnglfxviak-bfvorphasa-j
- molecular-weight:
- 1015.898