Difference between revisions of "3-hydroxypimeloyl-ACP-methyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.23.1-RXN 3.4.23.1-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:metabolite == Metabolite CPD-602 == * common-name: ** 5-amino-6-(5-phospho-d-ribosylamino)uracil * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-602 == |
− | * | + | * common-name: |
− | ** | + | ** 5-amino-6-(5-phospho-d-ribosylamino)uracil |
− | * | + | * smiles: |
− | ** [ | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2)) |
− | + | * inchi-key: | |
− | + | ** lzexycagpmyxlx-ummcilcdsa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 352.197 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RIBOFLAVINSYNDEAM-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=5-amino-6-(5-phospho-d-ribosylamino)uracil}} |
− | + | {{#set: inchi-key=inchikey=lzexycagpmyxlx-ummcilcdsa-l}} | |
− | + | {{#set: molecular-weight=352.197}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-602
- common-name:
- 5-amino-6-(5-phospho-d-ribosylamino)uracil
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
- inchi-key:
- lzexycagpmyxlx-ummcilcdsa-l
- molecular-weight:
- 352.197