|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13290 RXN-13290] == | + | == Metabolite N-ACETYL-GLUTAMYL-P == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 15-tetracosenoate—coa ligase | + | ** n-acetylglutamyl-phosphate |
| − | ** acyl-coa synthetase
| + | * smiles: |
| − | ** long-chain fatty acid-coa ligase | + | ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] |
| − | * ec-number:
| + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/6.2.1.3 ec-6.2.1.3] | + | ** fcvihfvsxhopsw-yfkpbyrvsa-k |
| − | == Reaction formula == | + | * molecular-weight: |
| − | * 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14268]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-14269]][c] '''+''' 1 [[PPI]][c]
| + | ** 266.124 |
| − | == Gene(s) associated with this reaction ==
| + | == Reaction(s) known to consume the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[ACETYLGLUTKIN-RXN]] |
| − | * Gene: [[SJ05591]]
| + | * [[N-ACETYLGLUTPREDUCT-RXN]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[ACETYLGLUTKIN-RXN]] |
| − | * Gene: [[SJ08692]]
| + | * [[AGK]] |
| − | ** Category: [[annotation]] | + | * [[N-ACETYLGLUTPREDUCT-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ08690]]
| + | {{#set: common-name=n-acetylglutamyl-phosphate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=266.124}} |
| − | * Gene: [[SJ03650]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ08691]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ13972]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=15-tetracosenoate—coa ligase|acyl-coa synthetase|long-chain fatty acid-coa ligase}} | |
| − | {{#set: ec-number=ec-6.2.1.3}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
