Difference between revisions of "CPD-11410"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7985 RXN-7985] == * direction: ** left-to-right * common-name: ** violaxanthin de-epoxidase **...")
(Created page with "Category:metabolite == Metabolite CPD-19490 == * common-name: ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate * smiles: ** csccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** x...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7985 RXN-7985] ==
+
== Metabolite CPD-19490 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** violaxanthin de-epoxidase
+
** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
−
** antheraxanthin de-epoxidase
+
* smiles:
−
* synonymous:
+
** csccccc(c(=o)c(=o)[o-])c(=o)[o-]
−
** vde
+
* inchi-key:
−
== Reaction formula ==
+
** xxjzwlkrfpcklb-uhfffaoysa-l
−
* 1 [[ASCORBATE]][c] '''+''' 1 [[CPD1F-131]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD1F-130]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 232.251
−
* Gene: [[SJ19927]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-18206]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[RXN-18206]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ03764]]
+
{{#set: common-name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=xxjzwlkrfpcklb-uhfffaoysa-l}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=232.251}}
−
* Gene: [[SJ20456]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5945]], violaxanthin, antheraxanthin and zeaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21801 21801]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07179 R07179]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=violaxanthin de-epoxidase|antheraxanthin de-epoxidase}}
 
−
{{#set: synonymous=vde}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-19490

  • common-name:
    • 3-isopropyl-7-(methylthio)-2-oxoheptanoate
  • smiles:
    • csccccc(c(=o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • xxjzwlkrfpcklb-uhfffaoysa-l
  • molecular-weight:
    • 232.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-11410&oldid=47545"