Difference between revisions of "CPD1G-773"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-9 RXN6666-9] == * direction: ** left-to-right * common-name: ** dopamine sulfotransferase *...")
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-9 RXN6666-9] ==
+
== Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** dopamine sulfotransferase
+
** (13s)-hpode
** aryl sulfotransferase
+
* smiles:
* ec-number:
+
** cccccc(c=cc=ccccccccc(=o)[o-])oo
** [http://enzyme.expasy.org/EC/2.8.2.1 ec-2.8.2.1]
+
* inchi-key:
== Reaction formula ==
+
** jdsrhvwsamtssn-irqzeampsa-m
* 1 [[DOPAMINE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-7649]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 311.44
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ01900]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[LIPOXYGENASE-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=(13s)-hpode}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}}
* Gene: [[SJ07550]]
+
{{#set: molecular-weight=311.44}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ19194]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ10094]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ06276]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ00192]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ05841]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY6666-2]], dopamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=dopamine sulfotransferase|aryl sulfotransferase}}
 
{{#set: ec-number=ec-2.8.2.1}}
 
{{#set: nb gene associated=7}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE

  • common-name:
    • (13s)-hpode
  • smiles:
    • cccccc(c=cc=ccccccccc(=o)[o-])oo
  • inchi-key:
    • jdsrhvwsamtssn-irqzeampsa-m
  • molecular-weight:
    • 311.44

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality