Difference between revisions of "CPD0-1027"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17873 RXN-17873] == * direction: ** left-to-right * common-name: ** methionine aminopeptidase *...")
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17873 RXN-17873] ==
+
== Metabolite CPD-7279 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** methionine aminopeptidase
+
** 2-cis,4-trans-xanthoxin
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.4.11.18 ec-3.4.11.18]
+
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
== Reaction formula ==
+
* inchi-key:
* 1 [[L-methionyl-L-alanyl-Protein]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[MET]][c] '''+''' 1 [[N-terminal-L-alanine]][c]
+
** ztalkmxohwqnia-tvbshjcbsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18138]]
+
** 250.337
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.1.288-RXN]]
* Gene: [[SJ16939]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-698]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
* Gene: [[SJ16932]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=2-cis,4-trans-xanthoxin}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
* Gene: [[SJ02903]]
+
{{#set: molecular-weight=250.337}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ01604]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ16573]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
 
** '''6''' reactions found over '''21''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=methionine aminopeptidase}}
 
{{#set: ec-number=ec-3.4.11.18}}
 
{{#set: nb gene associated=6}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-7279

  • common-name:
    • 2-cis,4-trans-xanthoxin
  • smiles:
    • cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
  • inchi-key:
    • ztalkmxohwqnia-tvbshjcbsa-n
  • molecular-weight:
    • 250.337

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality