Difference between revisions of "3Z-dodec-3-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] == * direction: ** left-to-right * common-name: ** arginyl-trna--protein trans...")
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] ==
+
== Metabolite CPD-15653 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** arginyl-trna--protein transferase
+
** (3r)-hydroxy, 6-cis-tridecenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.2.8 ec-2.3.2.8]
+
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Charged-ARG-tRNAs]][c] '''+''' 1 [[L-Glutamyl-Peptides]][c] '''=>''' 1 [[ARG-tRNAs]][c] '''+''' 1 [[L-arginyl-L-Glutamyl-Peptides]][c] '''+''' 1 [[PROTON]][c]
+
** adzjvtnixnsngu-ukoyhulusa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03517]]
+
** 973.818
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-14772]]
−
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
+
== Reaction(s) of unknown directionality ==
−
** '''7''' reactions found over '''14''' reactions in the full pathway
+
{{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=973.818}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=arginyl-trna--protein transferase}}
 
−
{{#set: ec-number=ec-2.3.2.8}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-15653

  • common-name:
    • (3r)-hydroxy, 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ukoyhulusa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3Z-dodec-3-enoyl-ACPs&oldid=47602"