Difference between revisions of "3Z-dodec-3-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] == * direction: ** left-to-right * common-name: ** arginyl-trna--protein trans...") |
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15653 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (3r)-hydroxy, 6-cis-tridecenoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | == | + | * inchi-key: |
− | + | ** adzjvtnixnsngu-ukoyhulusa-j | |
− | = | + | * molecular-weight: |
− | + | ** 973.818 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | *** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-14772]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}} | |
− | * | + | {{#set: molecular-weight=973.818}} |
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-15653
- common-name:
- (3r)-hydroxy, 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- adzjvtnixnsngu-ukoyhulusa-j
- molecular-weight:
- 973.818