Difference between revisions of "CPD-15653"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5038 RXN0-5038] == * direction: ** left-to-right * common-name: ** 3',5'-cyclic-amp phosphodie...")
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5038 RXN0-5038] ==
+
== Metabolite CPD-15689 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 3',5'-cyclic-amp phosphodiesterase
+
** (2e,5e)-dodeca-2,5-dienoyl-coa
** camp phosphodiesterase
+
* smiles:
* ec-number:
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
** [http://enzyme.expasy.org/EC/3.1.4.53 ec-3.1.4.53]
+
* inchi-key:
== Reaction formula ==
+
** zsjrxhrcabosnc-uovvplbnsa-j
* 1 [[CAMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 941.776
* Gene: [[SJ09726]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-14801]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ10845]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}}
* Gene: [[SJ14526]]
+
{{#set: molecular-weight=941.776}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ18679]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ04705]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25278 25278]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00191 R00191]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=3',5'-cyclic-amp phosphodiesterase|camp phosphodiesterase}}
 
{{#set: ec-number=ec-3.1.4.53}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-15689

  • common-name:
    • (2e,5e)-dodeca-2,5-dienoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-uovvplbnsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality