Difference between revisions of "2-HYDROXYPHYTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15067 RXN-15067] == * direction: ** left-to-right * common-name: ** phospholipase a2 * ec-numbe...")
(Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=n...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15067 RXN-15067] ==
+
== Metabolite FAD ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phospholipase a2
+
** fad
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.1.4 ec-3.1.1.4]
+
** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8291]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-8355]][c] '''+''' 1 [[OLEATE-CPD]][c] '''+''' 1 [[PROTON]][c]
+
** imgvnjnccgxbhd-uybvjogssa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 782.533
−
* Gene: [[SJ04543]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[ACOA120OR]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ACOA140OR]]
−
* Gene: [[SJ12662]]
+
* [[ACOA160OR]]
−
** Category: [[annotation]]
+
* [[ACOA40OR]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ACOA80OR]]
−
* Gene: [[SJ09888]]
+
* [[ACOAD1f]]
−
** Category: [[annotation]]
+
* [[FAD-PYROPHOSPHATASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[IVCDH]]
−
* Gene: [[SJ18009]]
+
* [[MCDH]]
−
** Category: [[annotation]]
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PPCOAOm]]
−
* Gene: [[SJ06461]]
+
* [[RXN-11695]]
−
** Category: [[annotation]]
+
* [[RXN-14264]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[SUCDHm]]
−
* Gene: [[SJ13501]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ACOAD1f]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[FAD-PYROPHOSPHATASE-RXN]]
−
* Gene: [[SJ02841]]
+
* [[FADSYN-RXN]]
−
** Category: [[annotation]]
+
* [[PPCOAOm]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-11695]]
−
* Gene: [[SJ16853]]
+
* [[RXN-14264]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=fad}}
−
</div>
+
{{#set: inchi-key=inchikey=imgvnjnccgxbhd-uybvjogssa-k}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=782.533}}
−
* [[PWY-7409]], phospholipid remodeling (phosphatidylethanolamine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7409 PWY-7409]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phospholipase a2}}
 
−
{{#set: ec-number=ec-3.1.1.4}}
 
−
{{#set: nb gene associated=8}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite FAD

  • common-name:
    • fad
  • smiles:
    • cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
  • inchi-key:
    • imgvnjnccgxbhd-uybvjogssa-k
  • molecular-weight:
    • 782.533

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-HYDROXYPHYTANOYL-COA&oldid=47661"