Difference between revisions of "CPD-698"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOOHBUTREDUCTOISOM-RXN ACETOOHBUTREDUCTOISOM-RXN] == * direction: ** left-to-right * common-name...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine |
− | * | + | * smiles: |
− | ** [ | + | ** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c |
− | + | * inchi-key: | |
− | + | ** zrjhlgyvucpznh-mqwkrirwsa-o | |
− | + | * molecular-weight: | |
− | * | + | ** 205.276 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9896]] |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | * [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | {{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}} |
− | + | {{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}} | |
− | * [[ | + | {{#set: molecular-weight=205.276}} |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE
- common-name:
- 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
- smiles:
- c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
- inchi-key:
- zrjhlgyvucpznh-mqwkrirwsa-o
- molecular-weight:
- 205.276