|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOOHBUTREDUCTOISOM-RXN ACETOOHBUTREDUCTOISOM-RXN] == | + | == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 2-aceto-2-hydroxy-butyrate:nadph+ oxidoreductase (isomerizing) | + | ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.86 ec-1.1.1.86] | + | ** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[2-ACETO-2-HYDROXY-BUTYRATE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[1-KETO-2-METHYLVALERATE]][c] '''+''' 1 [[NADP]][c]
| + | ** zrjhlgyvucpznh-mqwkrirwsa-o |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ10245]] | + | ** 205.276 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-9896]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]] |
| − | == Pathway(s) == | + | == Reaction(s) of unknown directionality == |
| − | * [[ILEUSYN-PWY]], L-isoleucine biosynthesis I (from threonine): [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] | + | {{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}} |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}} |
| − | * [[PWY-5103]], L-isoleucine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5103 PWY-5103] | + | {{#set: molecular-weight=205.276}} |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13493 13493]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P06168 P06168]
| |
| − | ** [http://www.uniprot.org/uniprot/P44822 P44822]
| |
| − | ** [http://www.uniprot.org/uniprot/O25097 O25097]
| |
| − | ** [http://www.uniprot.org/uniprot/Q02138 Q02138]
| |
| − | ** [http://www.uniprot.org/uniprot/Q57179 Q57179]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTI3 Q9JTI3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PHN5 Q9PHN5]
| |
| − | ** [http://www.uniprot.org/uniprot/P05793 P05793]
| |
| − | ** [http://www.uniprot.org/uniprot/P38674 P38674]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59500 Q59500]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01292 Q01292]
| |
| − | ** [http://www.uniprot.org/uniprot/Q05758 Q05758]
| |
| − | ** [http://www.uniprot.org/uniprot/O82043 O82043]
| |
| − | ** [http://www.uniprot.org/uniprot/P78827 P78827]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=2-aceto-2-hydroxy-butyrate:nadph+ oxidoreductase (isomerizing)}} | |
| − | {{#set: ec-number=ec-1.1.1.86}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
