Difference between revisions of "CPD-13887"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HPPD HPPD] == * direction: ** left-to-right * common-name: ** p-hydroxyphenylpyruvate dioxygenase =...") |
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DPG == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phospho-d-glyceroyl-phosphate |
| − | + | * smiles: | |
| − | * | + | ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] |
| − | == | + | * inchi-key: |
| − | * | + | ** ljqlqcaxbuheaz-uwtatzphsa-j |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 262.006 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] | |
| − | * | + | * [[GAPDHSYNEC-RXN]] |
| − | == | + | * [[GAPDH_]] |
| − | {{#set: | + | * [[GAPOXNPHOSPHN-RXN]] |
| − | + | * [[PHOSGLYPHOS-RXN]] | |
| − | {{#set: | + | * [[RXN-17274]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[GAPDHSYNEC-RXN]] |
| − | + | * [[GAPDH_]] | |
| − | + | * [[GAPOXNPHOSPHN-RXN]] | |
| − | + | * [[PHOSGLYPHOS-RXN]] | |
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-phospho-d-glyceroyl-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}} | ||
| + | {{#set: molecular-weight=262.006}} | ||
Revision as of 20:35, 18 December 2020
Contents
Metabolite DPG
- common-name:
- 3-phospho-d-glyceroyl-phosphate
- smiles:
- c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
- inchi-key:
- ljqlqcaxbuheaz-uwtatzphsa-j
- molecular-weight:
- 262.006
