Difference between revisions of "CPD-700"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CL- ExchangeSeed-CL-] == * direction: ** reversible == Reaction formula == * 1.0 CL-...") |
(Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl * inchi-key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12676 == |
− | * | + | * common-name: |
− | ** | + | ** 5'-chloro-5'-deoxyadenosine |
− | == | + | * smiles: |
− | * | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl |
− | + | * inchi-key: | |
− | == | + | ** iysnpomtkfzdhz-kqynxxcusa-n |
− | + | * molecular-weight: | |
− | * | + | ** 285.689 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11715]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=5'-chloro-5'-deoxyadenosine}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}} |
− | + | {{#set: molecular-weight=285.689}} | |
− | {{#set: |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-12676
- common-name:
- 5'-chloro-5'-deoxyadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
- inchi-key:
- iysnpomtkfzdhz-kqynxxcusa-n
- molecular-weight:
- 285.689