Difference between revisions of "CPD-713"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17785 RXN-17785] == * direction: ** left-to-right * common-name: ** enoyl-coa hydratase * ec-nu...") |
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * smiles: ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) * inchi-key: ** ikmd...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite MYRICETIN == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** myricetin |
− | * | + | * smiles: |
− | ** | + | ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) |
− | == | + | * inchi-key: |
− | + | ** ikmdfbphznjcsn-uhfffaoysa-m | |
− | + | * molecular-weight: | |
− | + | ** 317.231 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8450]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=myricetin}} | |
− | * | + | {{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}} |
− | + | {{#set: molecular-weight=317.231}} | |
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | == | ||
− | == | ||
− | * | ||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite MYRICETIN
- common-name:
- myricetin
- smiles:
- c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
- inchi-key:
- ikmdfbphznjcsn-uhfffaoysa-m
- molecular-weight:
- 317.231