Difference between revisions of "CPD-11770"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] == * direction: ** reversible == Reaction formula == * 1 UREA[c]...") |
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OLEATE-CPD == |
− | * | + | * common-name: |
− | ** | + | ** oleate |
− | == Reaction | + | * smiles: |
− | * | + | ** ccccccccc=ccccccccc([o-])=o |
− | == | + | * inchi-key: |
− | * | + | ** zqppmhvwecsirj-ktkrtigzsa-m |
− | ** | + | * molecular-weight: |
− | * | + | ** 281.457 |
− | * | + | == Reaction(s) known to consume the compound == |
− | + | * [[FACOAL18111Z]] | |
− | + | * [[RXN-10756]] | |
− | * | + | * [[RXN-9644]] |
− | == | + | * [[RXN0-7239]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[FACOAE18111Z]] |
− | + | * [[RXN-10756]] | |
− | {{#set: | + | * [[RXN-15035]] |
− | + | * [[RXN-15067]] | |
− | + | * [[RXN-15068]] | |
− | + | * [[RXN-15088]] | |
+ | * [[RXN-15089]] | ||
+ | * [[RXN-15133]] | ||
+ | * [[RXN-15135]] | ||
+ | * [[RXN-9666]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=oleate}} | ||
+ | {{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}} | ||
+ | {{#set: molecular-weight=281.457}} |
Revision as of 20:36, 18 December 2020
Contents
Metabolite OLEATE-CPD
- common-name:
- oleate
- smiles:
- ccccccccc=ccccccccc([o-])=o
- inchi-key:
- zqppmhvwecsirj-ktkrtigzsa-m
- molecular-weight:
- 281.457
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- FACOAE18111Z
- RXN-10756
- RXN-15035
- RXN-15067
- RXN-15068
- RXN-15088
- RXN-15089
- RXN-15133
- RXN-15135
- RXN-9666