Difference between revisions of "CPD-4161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10915 RXN-10915] == * direction: ** reversible * common-name: ** 3,4-dihydroxyphenylglycol dehy...")
(Created page with "Category:metabolite == Metabolite CPD-12126 == * common-name: ** menaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10915 RXN-10915] ==
+
== Metabolite CPD-12126 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3,4-dihydroxyphenylglycol dehydrogenase
+
** menaquinol-9
−
** 3-methoxy-4-hydroxyphenylglycol dehydrogenase
+
* smiles:
−
** alcohol dehydrogenase (nad)
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
−
* ec-number:
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/1.1.1.1 ec-1.1.1.1]
+
** knwzipkbogoffc-uvzvdvbnsa-n
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[CPD-11497]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-11876]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** 787.263
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ21601]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-9205]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ07759]]
+
{{#set: common-name=menaquinol-9}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=knwzipkbogoffc-uvzvdvbnsa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=787.263}}
−
* Gene: [[SJ14768]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
 
−
** '''8''' reactions found over '''13''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=alcohol dehydrogenase (nad)|3,4-dihydroxyphenylglycol dehydrogenase|3-methoxy-4-hydroxyphenylglycol dehydrogenase}}
 
−
{{#set: ec-number=ec-1.1.1.1}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-12126

  • common-name:
    • menaquinol-9
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • knwzipkbogoffc-uvzvdvbnsa-n
  • molecular-weight:
    • 787.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4161&oldid=47951"