Difference between revisions of "CPD-9089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD6h HACD6h] == * direction: ** reversible * common-name: ** 3-hydroxyacyl-coa dehydrogenase (c14...")
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD6h HACD6h] ==
+
== Metabolite CPD-15424 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3-hydroxyacyl-coa dehydrogenase (c14:0)
+
** o-carbamoyladenylate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CPD-10284]][h] '''+''' 1.0 [[NADH]][h] '''+''' 1.0 [[PROTON]][h] '''<=>''' 1.0 [[CPD0-2171]][h] '''+''' 1.0 [[NAD]][h]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21390]]
+
** chsnpofvfypelh-kqynxxcusa-m
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 389.241
−
* Gene: [[SJ03584]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-13167]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13168]]
−
== Pathway(s) ==
+
* [[RXN-14553]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14552]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=reversible}}
+
{{#set: common-name=o-carbamoyladenylate}}
−
{{#set: common-name=3-hydroxyacyl-coa dehydrogenase (c14:0)}}
+
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
−
{{#set: nb gene associated=2}}
+
{{#set: molecular-weight=389.241}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-15424

  • common-name:
    • o-carbamoyladenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
  • inchi-key:
    • chsnpofvfypelh-kqynxxcusa-m
  • molecular-weight:
    • 389.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9089&oldid=47986"