Difference between revisions of "Single-Stranded-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALKANE-1-MONOOXYGENASE-RXN ALKANE-1-MONOOXYGENASE-RXN] == * direction: ** left-to-right * common-na...")
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALKANE-1-MONOOXYGENASE-RXN ALKANE-1-MONOOXYGENASE-RXN] ==
+
== Metabolite CPD-11674 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** alkane hydroxylase
+
** 5-hydroxytryptophol sulfate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.15.3 ec-1.14.15.3]
+
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-148]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-Rubredoxins]][c] '''=>''' 1 [[OCTANOL]][c] '''+''' 2 [[Oxidized-Rubredoxins]][c] '''+''' 1 [[WATER]][c]
+
** focuajyuoxsnds-uhfffaoysa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ07069]]
+
** 256.253
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-10782]]
* [[P221-PWY]], octane oxidation: [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY]
+
== Reaction(s) of unknown directionality ==
** '''3''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=5-hydroxytryptophol sulfate}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=256.253}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19342 19342]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02879 R02879]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P12691 P12691]
 
** [http://www.uniprot.org/uniprot/P14580 P14580]
 
** [http://www.uniprot.org/uniprot/P14579 P14579]
 
** [http://www.uniprot.org/uniprot/Q02928 Q02928]
 
** [http://www.uniprot.org/uniprot/P08516 P08516]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=alkane hydroxylase}}
 
{{#set: ec-number=ec-1.14.15.3}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-11674

  • common-name:
    • 5-hydroxytryptophol sulfate
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
  • inchi-key:
    • focuajyuoxsnds-uhfffaoysa-m
  • molecular-weight:
    • 256.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality