Difference between revisions of "DIHYDROXYACETONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] == * direction: ** left-to-right * common-name: ** adp-ribose pyrophosphatase...")
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * mol...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] ==
+
== Metabolite ANTHRANILATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** adp-ribose pyrophosphatase
+
** anthranilate
** adp-ribose diphosphatase
+
* smiles:
* ec-number:
+
** c(c1(c(=cc=cc=1)n))(=o)[o-]
** [http://enzyme.expasy.org/EC/3.6.1.53 ec-3.6.1.53]
+
* inchi-key:
** [http://enzyme.expasy.org/EC/3.6.1.13 ec-3.6.1.13]
+
** rwzyaggxghygmb-uhfffaoysa-m
== Reaction formula ==
+
* molecular-weight:
* 1 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-15317]][c] '''+''' 2 [[PROTON]][c]
+
** 136.13
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ00357]]
+
* [[ANTHRANSYN-RXN]]
** Category: [[orthology]]
+
* [[PRTRANS-RXN]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ANTHRANSYN-RXN]]
* Gene: [[SJ06120]]
+
* [[PRTRANS-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=anthranilate}}
* Gene: [[SJ08998]]
+
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=136.13}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ07747]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ13701]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10413 10413]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01054 R01054]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=adp-ribose diphosphatase|adp-ribose pyrophosphatase}}
 
{{#set: ec-number=ec-3.6.1.53|ec-3.6.1.13}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite ANTHRANILATE

  • common-name:
    • anthranilate
  • smiles:
    • c(c1(c(=cc=cc=1)n))(=o)[o-]
  • inchi-key:
    • rwzyaggxghygmb-uhfffaoysa-m
  • molecular-weight:
    • 136.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality