Difference between revisions of "Hyaluronan-glucuronate-terminal"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12710 RXN-12710] == * direction: ** left-to-right * common-name: ** 3-oxoacyl coa thiolase ** a...")
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12710 RXN-12710] ==
+
== Metabolite CPD1F-129 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxoacyl coa thiolase
+
** β-carotene
−
** acetyl-coa c-acyltransferase
+
* smiles:
−
* ec-number:
+
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
−
** [http://enzyme.expasy.org/EC/2.3.1.16 ec-2.3.1.16]
+
* inchi-key:
−
== Reaction formula ==
+
** oenhqhleoonyie-jltxgrslsa-n
−
* 1 [[CO-A]][c] '''+''' 1 [[CPD-13699]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-13700]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 536.882
−
* Gene: [[SJ16470]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13641]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8025]]
−
* Gene: [[SJ21817]]
+
* [[RXN1F-152]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13641]]
−
* Gene: [[SJ14898]]
+
* [[RXN1F-151]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=β-carotene}}
−
* Gene: [[SJ21818]]
+
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=536.882}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ09371]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6945]], cholesterol degradation to androstenedione I (cholesterol oxidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6945 PWY-6945]
 
−
** '''5''' reactions found over '''17''' reactions in the full pathway
 
−
* [[PWY-6946]], cholesterol degradation to androstenedione II (cholesterol dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6946 PWY-6946]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
* [[PWY-6948]], sitosterol degradation to androstenedione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6948 PWY-6948]
 
−
** '''2''' reactions found over '''18''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxoacyl coa thiolase|acetyl-coa c-acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.16}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD1F-129

  • common-name:
    • β-carotene
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
  • inchi-key:
    • oenhqhleoonyie-jltxgrslsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Hyaluronan-glucuronate-terminal&oldid=48124"