Difference between revisions of "N-Substituted-Aminoacyl-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11057 RXN-11057] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc(=n)c(=o)[o-] * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11057 RXN-11057] ==
+
== Metabolite IMINOASPARTATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 2-iminosuccinate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.14.1 ec-1.14.14.1]
+
** c(=o)([o-])cc(=n)c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[N-ACETYL-5-METHOXY-TRYPTAMINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[FORMALDEHYDE]][c] '''+''' 1 [[N-ACETYL-SEROTONIN]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
+
** nmuoatvllqeyhi-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19505]]
+
** 129.072
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[QUINOLINATE-SYNTHA-RXN]]
−
* Gene: [[SJ12861]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[L-ASPARTATE-OXID-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-9772]]
−
* Gene: [[SJ18127]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=2-iminosuccinate}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=nmuoatvllqeyhi-uhfffaoysa-l}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=129.072}}
−
* [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.14.1}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:37, 18 December 2020

Metabolite IMINOASPARTATE

  • common-name:
    • 2-iminosuccinate
  • smiles:
    • c(=o)([o-])cc(=n)c(=o)[o-]
  • inchi-key:
    • nmuoatvllqeyhi-uhfffaoysa-l
  • molecular-weight:
    • 129.072

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-Substituted-Aminoacyl-tRNA&oldid=48183"