Difference between revisions of "CPD-12902"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7667 RXN-7667] == * direction: ** left-to-right * common-name: ** udp-α-d-glucose:glucosy...") |
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2) |
| − | = | + | * inchi-key: |
| − | + | ** kfeujdwyngmdbv-rphkzzmbsa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 383.352 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-15268]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]] |
| − | + | * [[RXN-15268]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}} |
| − | == | + | {{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}} |
| − | + | {{#set: molecular-weight=383.352}} | |
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE
- common-name:
- β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
- inchi-key:
- kfeujdwyngmdbv-rphkzzmbsa-n
- molecular-weight:
- 383.352
