Difference between revisions of "CPD-10814"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81. RXN-...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == |
− | * | + | * common-name: |
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol |
− | == | + | * smiles: |
− | * | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | == | + | ** hdsgdgslnmimku-kfsstaeesa-n |
− | + | * molecular-weight: | |
− | * | + | ** 699.111 |
− | == | + | == Reaction(s) known to consume the compound == |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}} |
− | + | {{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}} | |
− | + | {{#set: molecular-weight=699.111}} | |
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ
- common-name:
- 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- hdsgdgslnmimku-kfsstaeesa-n
- molecular-weight:
- 699.111