Difference between revisions of "CPD-8892"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOPARATHION-PHOSPHATASE-RXN AMINOPARATHION-PHOSPHATASE-RXN] == * direction: ** left-to-right * c...") |
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD0-2106 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxooctanoyl-coa |
− | + | * smiles: | |
− | + | ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | * | + | ** wpivbcgrgvnddt-cecatxlmsa-j |
− | ** | + | * molecular-weight: |
− | + | ** 903.684 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]] | |
− | = | + | * [[RXN-14277]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]] |
− | *** | + | * [[RXN-14275]] |
− | + | * [[RXN-14277]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=3-oxooctanoyl-coa}} |
− | == | + | {{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}} |
− | + | {{#set: molecular-weight=903.684}} | |
− | * | ||
− | * | ||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD0-2106
- common-name:
- 3-oxooctanoyl-coa
- smiles:
- cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- wpivbcgrgvnddt-cecatxlmsa-j
- molecular-weight:
- 903.684