Difference between revisions of "Charged-ILE-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == * direction: ** left-to-right * common-name: ** trna-specific 2-thiouridyla...")
(Created page with "Category:metabolite == Metabolite CPD-8077 == * common-name: ** 1-18:1-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] ==
+
== Metabolite CPD-8077 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna-specific 2-thiouridylase
+
** 1-18:1-2-16:2-monogalactosyldiacylglycerol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.13 ec-2.8.1.13]
+
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[TusE-S-sulfanylcysteine]][c] '''+''' 1 [[tRNA-uridine34]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[TusE-L-cysteine]][c] '''+''' 1 [[tRNA-2-thiouridine34]][c]
+
** sfkzppodzmclpe-nhgajdlwsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13939]]
+
** 753.067
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8303]]
−
* Gene: [[SJ00619]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=1-18:1-2-16:2-monogalactosyldiacylglycerol}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=sfkzppodzmclpe-nhgajdlwsa-n}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=753.067}}
−
== Pathway(s) ==
 
−
* [[PWY-7892]], tRNA-uridine 2-thiolation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7892 PWY-7892]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna-specific 2-thiouridylase}}
 
−
{{#set: ec-number=ec-2.8.1.13}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-8077

  • common-name:
    • 1-18:1-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • sfkzppodzmclpe-nhgajdlwsa-n
  • molecular-weight:
    • 753.067

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Charged-ILE-tRNAs&oldid=48376"