Difference between revisions of "44-DIMETHYL-CHOLESTA-814-24-TRIENOL"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-NUCLEOTID-RXN 5-NUCLEOTID-RXN] == * direction: ** left-to-right * common-name: ** pyrimidine nucl...") |
(Created page with "Category:metabolite == Metabolite CPD-4205 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-4205 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate |
− | + | * smiles: | |
− | * | + | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c |
− | ** | + | * inchi-key: |
− | == | + | ** duiszflwbaprbr-sdbhatresa-l |
− | + | * molecular-weight: | |
− | = | + | ** 413.326 |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-4311]] |
− | + | * [[RXN-4313]] | |
− | + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | |
− | ** | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-4307]] | |
− | + | * [[RXN-4311]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}} | |
− | + | {{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}} | |
− | + | {{#set: molecular-weight=413.326}} | |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * | ||
− | * | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name=5'- | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-4205
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- duiszflwbaprbr-sdbhatresa-l
- molecular-weight:
- 413.326
Reaction(s) known to consume the compound
- RXN-4311
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.