Difference between revisions of "TRNAPhe-Containing-4-demethylwyosine-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.1-RXN 3.2.1.1-RXN] == * direction: ** left-to-right * common-name: ** alpha-amylase * ec-numb...")
(Created page with "Category:metabolite == Metabolite CPD-663 == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.1-RXN 3.2.1.1-RXN] ==
+
== Metabolite CPD-663 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** alpha-amylase
+
** udp-4-dehydro-6-deoxy-α-d-glucose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.2.1.1 ec-3.2.1.1]
+
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Starch]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Glucose]][c] '''+''' 1 [[MALTOSE]][c]
+
** ddwgqqadoimfoi-jphisprksa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00547]]
+
** 546.274
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-18332]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-18332]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}}
−
{{#set: common-name=alpha-amylase}}
+
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}}
−
{{#set: ec-number=ec-3.2.1.1}}
+
{{#set: molecular-weight=546.274}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-663

  • common-name:
    • udp-4-dehydro-6-deoxy-α-d-glucose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
  • inchi-key:
    • ddwgqqadoimfoi-jphisprksa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNAPhe-Containing-4-demethylwyosine-37&oldid=48398"