Difference between revisions of "TRNAPhe-Containing-4-demethylwyosine-37"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.1-RXN 3.2.1.1-RXN] == * direction: ** left-to-right * common-name: ** alpha-amylase * ec-numb...") |
(Created page with "Category:metabolite == Metabolite CPD-663 == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-663 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** alpha- | + | ** udp-4-dehydro-6-deoxy-α-d-glucose |
− | * | + | * smiles: |
− | ** [ | + | ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3) |
− | == | + | * inchi-key: |
− | + | ** ddwgqqadoimfoi-jphisprksa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 546.274 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-18332]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-18332]] |
− | * | + | * [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}} |
− | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=546.274}} |
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-663
- common-name:
- udp-4-dehydro-6-deoxy-α-d-glucose
- smiles:
- cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
- inchi-key:
- ddwgqqadoimfoi-jphisprksa-l
- molecular-weight:
- 546.274