Difference between revisions of "Pre-tRNA-3-prime-half-molecules"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] == * direction: ** left-to-right * common-name: ** 2-acyl-1-alkyl-sn-glycerol...")
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] ==
+
== Metabolite CPD-2189 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 2-acyl-1-alkyl-sn-glycerol ethanolaminephosphotransferase
+
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
** ethanolaminephosphotransferase
+
* smiles:
* ec-number:
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
** [http://enzyme.expasy.org/EC/2.7.8.1 ec-2.7.8.1]
+
* inchi-key:
== Reaction formula ==
+
** djvqakqvqxihel-uilgywmgsa-n
* 1 [[1-Alkyl-2-acyl-glycerol]][c] '''+''' 1 [[CDP-ETHANOLAMINE]][c] '''=>''' 1 [[1-Alkyl-2-acyl-glycerol-P-Etn]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 751.052
* Gene: [[SJ19317]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-8299]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8306]]
* Gene: [[SJ16464]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
+
{{#set: molecular-weight=751.052}}
** '''11''' reactions found over '''16''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=2-acyl-1-alkyl-sn-glycerol ethanolaminephosphotransferase|ethanolaminephosphotransferase}}
 
{{#set: ec-number=ec-2.7.8.1}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-2189

  • common-name:
    • 1-18:2-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • djvqakqvqxihel-uilgywmgsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality