Difference between revisions of "CPD-13852"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242] ==
+
== Metabolite TRP ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** l-tryptophan
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.201 ec-2.1.1.201]
+
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-9870]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-9872]][c] '''+''' 1 [[PROTON]][c]
+
** qivbcdijiajpqs-vifpvbqesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 204.228
−
* Gene: [[SJ02693]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8665]]
−
* Gene: [[SJ11297]]
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
−
** Category: [[annotation]]
+
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
−
* Gene: [[SJ20751]]
+
* [[biomass_rxn]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-2382]]
−
* Gene: [[SJ02842]]
+
* [[TRYPSYN-RXN]]
−
** Category: [[annotation]]
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ00609]]
+
{{#set: common-name=l-tryptophan}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=204.228}}
−
* Gene: [[SJ11757]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ07072]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-5856]], ubiquinol-9 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5871]], ubiquinol-9 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44761 44761]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.1.1.201}}
 
−
{{#set: nb gene associated=7}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite TRP

  • common-name:
    • l-tryptophan
  • smiles:
    • c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
  • inchi-key:
    • qivbcdijiajpqs-vifpvbqesa-n
  • molecular-weight:
    • 204.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13852&oldid=48458"