Difference between revisions of "CHONDROITIN-4-SULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11976 RXN-11976] == * direction: ** left-to-right * common-name: ** torulene synthase * ec-numb...")
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11976 RXN-11976] ==
+
== Metabolite CPD0-341 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** torulene synthase
+
** s-succinyl-dihydrolipoamide
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1 ec-2.5.1]
+
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-12932]][c] '''=>''' 1 [[CPD-7953]][c]
+
** rjcjwoncskshes-vifpvbqesa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
== Pathway(s) ==
+
** 306.414
* [[PWY-6681]], neurosporaxanthin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6681 PWY-6681]
+
== Reaction(s) known to consume the compound ==
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[AKGDHe2r]]
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
* [[AKGDHe2r]]
== External links  ==
+
* [[AKGDHmi]]
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
{{#set: common-name=torulene synthase}}
+
{{#set: common-name=s-succinyl-dihydrolipoamide}}
{{#set: ec-number=ec-2.5.1}}
+
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
{{#set: nb gene associated=0}}
+
{{#set: molecular-weight=306.414}}
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=gap-filling}}
 
{{#set: reconstruction tool=meneco}}
 
{{#set: reconstruction comment=added for gapfilling}}
 
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD0-341

  • common-name:
    • s-succinyl-dihydrolipoamide
  • smiles:
    • c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
  • inchi-key:
    • rjcjwoncskshes-vifpvbqesa-m
  • molecular-weight:
    • 306.414

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality