Difference between revisions of "CPD0-903"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] == * direction: ** left-to-right * common-name: ** 3-oxo-arachidoyl-coa reduct...") |
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GLUCONATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** d-gluconate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
− | + | * inchi-key: | |
− | + | ** rghnjxzeokukbd-sqougzdysa-m | |
− | + | * molecular-weight: | |
− | + | ** 195.149 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | *** | + | * [[GLUCONOKIN-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[GLUCONATE-5-DEHYDROGENASE-RXN]] |
− | + | * [[GLUCONOLACT-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=d-gluconate}} |
− | == | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}} |
− | + | {{#set: molecular-weight=195.149}} | |
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite GLUCONATE
- common-name:
- d-gluconate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sqougzdysa-m
- molecular-weight:
- 195.149