Difference between revisions of "PWY-7367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * common-name: ** trans-2,3-dehydroad...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == |
* common-name: | * common-name: | ||
− | ** | + | ** coumarinate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pmowtihvnwzyfi-waywqwqtsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 163.152 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8036]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=coumarinate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=163.152}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-7418
- common-name:
- coumarinate
- smiles:
- c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
- inchi-key:
- pmowtihvnwzyfi-waywqwqtsa-m
- molecular-weight:
- 163.152