Difference between revisions of "L-3-HYDROXYACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
(Created page with "Category:metabolite == Metabolite CPD-11020 == * common-name: ** 5-chloro-4-hydroxy-2-oxopentanoate * smiles: ** c(=o)([o-])c(=o)cc(o)ccl * inchi-key: ** fhwphvigzzaxiq-vk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11020 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-chloro-4-hydroxy-2-oxopentanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c(=o)cc(o)ccl |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fhwphvigzzaxiq-vkhmyheasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 165.553 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11717]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-chloro-4-hydroxy-2-oxopentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fhwphvigzzaxiq-vkhmyheasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=165.553}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-11020
- common-name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- smiles:
- c(=o)([o-])c(=o)cc(o)ccl
- inchi-key:
- fhwphvigzzaxiq-vkhmyheasa-m
- molecular-weight:
- 165.553
