Difference between revisions of "CPD-14154"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12906 == * common-name: ** 5-methyl-3-oxo-4-hexenoyl-coa * smiles: ** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(oc...")
(Created page with "Category:metabolite == Metabolite Apo-EntF == * common-name: ** an apo-[entf peptidyl-carrier protein] == Reaction(s) known to consume the compound == * RXN-15889 == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12906 ==
+
== Metabolite Apo-EntF ==
 
* common-name:
 
* common-name:
** 5-methyl-3-oxo-4-hexenoyl-coa
+
** an apo-[entf peptidyl-carrier protein]
* smiles:
 
** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** zfkzvsujtdsjey-svhodsnwsa-j
 
* molecular-weight:
 
** 887.641
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11921]]
+
* [[RXN-15889]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
+
{{#set: common-name=an apo-[entf peptidyl-carrier protein]}}
{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
 
{{#set: molecular-weight=887.641}}
 

Revision as of 14:53, 5 January 2021

Metabolite Apo-EntF

  • common-name:
    • an apo-[entf peptidyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[entf peptidyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.