Difference between revisions of "3-Hydroxy-octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine-enolpyruvate * smiles: ** c=c(oc3(c(o)c(co)oc...") |
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-7-DIMETHYLXANTHINE == |
* common-name: | * common-name: | ||
− | ** | + | ** paraxanthine |
* smiles: | * smiles: | ||
− | ** | + | ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qunwudvfrngtco-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 180.166 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11520]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=paraxanthine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.166}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite 1-7-DIMETHYLXANTHINE
- common-name:
- paraxanthine
- smiles:
- cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
- inchi-key:
- qunwudvfrngtco-uhfffaoysa-n
- molecular-weight:
- 180.166