Difference between revisions of "3-Hydroxy-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine-enolpyruvate * smiles: ** c=c(oc3(c(o)c(co)oc...")
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE ==
+
== Metabolite 1-7-DIMETHYLXANTHINE ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-glucosamine-enolpyruvate
+
** paraxanthine
 
* smiles:
 
* smiles:
** c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-]
+
** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
 
* inchi-key:
 
* inchi-key:
** begzzypuncjhkp-dbywsuqtsa-k
+
** qunwudvfrngtco-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 674.382
+
** 180.166
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[RXN-11520]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-glucosamine-enolpyruvate}}
+
{{#set: common-name=paraxanthine}}
{{#set: inchi-key=inchikey=begzzypuncjhkp-dbywsuqtsa-k}}
+
{{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}}
{{#set: molecular-weight=674.382}}
+
{{#set: molecular-weight=180.166}}

Revision as of 14:53, 5 January 2021

Metabolite 1-7-DIMETHYLXANTHINE

  • common-name:
    • paraxanthine
  • smiles:
    • cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
  • inchi-key:
    • qunwudvfrngtco-uhfffaoysa-n
  • molecular-weight:
    • 180.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality