Difference between revisions of "Octanoylated-Gcv-H"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_ACETALDEHYDE == * common-name: ** (indol-3-yl)acetaldehyde * smiles: ** [ch](=o)cc1(c2(c(nc=1)=cc=cc=2)) * inchi-key: ** whooumghg...") |
(Created page with "Category:metabolite == Metabolite D-GLT == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxjrkmk-gsvougtgsa-m * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-GLT == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glutamate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccc(c(=o)[o-])[n+])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** whuutdbjxjrkmk-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.122 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glutamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=whuutdbjxjrkmk-gsvougtgsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.122}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite D-GLT
- common-name:
- d-glutamate
- smiles:
- c(ccc(c(=o)[o-])[n+])([o-])=o
- inchi-key:
- whuutdbjxjrkmk-gsvougtgsa-m
- molecular-weight:
- 146.122
