Difference between revisions of "CPD-11526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Myristoyl-ACPs == * common-name: ** a myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10727 * RXN-17017 * [...")
(Created page with "Category:metabolite == Metabolite CPD-18447 == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3))) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Myristoyl-ACPs ==
+
== Metabolite CPD-18447 ==
 
* common-name:
 
* common-name:
** a myristoyl-[acp]
+
** actinocin
 +
* smiles:
 +
** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3)))
 +
* inchi-key:
 +
** kxrmrepjuitwdu-uhfffaoysa-l
 +
* molecular-weight:
 +
** 326.265
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10727]]
+
* [[RXN-17077]]
* [[RXN-17017]]
 
* [[RXN-17022]]
 
* [[RXN-17024]]
 
* [[RXN-9539]]
 
* [[RXN-9654]]
 
* [[RXN3O-8214]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9538]]
+
* [[RXN-17077]]
* [[RXN-9662]]
 
* [[RXN3O-8214]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a myristoyl-[acp]}}
+
{{#set: common-name=actinocin}}
 +
{{#set: inchi-key=inchikey=kxrmrepjuitwdu-uhfffaoysa-l}}
 +
{{#set: molecular-weight=326.265}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-18447

  • common-name:
    • actinocin
  • smiles:
    • cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3)))
  • inchi-key:
    • kxrmrepjuitwdu-uhfffaoysa-l
  • molecular-weight:
    • 326.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality