Difference between revisions of "TRNA-fragment"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11715 == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) * inchi-key: ** utyvdvlmyqplqb-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite CPD-8646 == * common-name: ** 7-dehydrodesmosterol * smiles: ** cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)(c(=cc=c23)cc(o)cc4)))) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8646 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-dehydrodesmosterol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)(c(=cc=c23)cc(o)cc4)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** russpkpuxdshnc-ddpqnldtsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 382.628 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-27]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11887]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-dehydrodesmosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=russpkpuxdshnc-ddpqnldtsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=382.628}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-8646
- common-name:
- 7-dehydrodesmosterol
- smiles:
- cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)(c(=cc=c23)cc(o)cc4))))
- inchi-key:
- russpkpuxdshnc-ddpqnldtsa-n
- molecular-weight:
- 382.628
