Difference between revisions of "CPD-15979"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Octanoyl-ACPs == * common-name: ** an octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-13037 * RXN-9527 * R...") |
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * common-name: ** d-erythro-imidazole-glycerol-phosphate * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-erythro-imidazole-glycerol-phosphate |
| + | * smiles: | ||
| + | ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o) | ||
| + | * inchi-key: | ||
| + | ** hfybthcypkedqq-ritpcoansa-l | ||
| + | * molecular-weight: | ||
| + | ** 236.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[IGPD]] |
| − | * [[ | + | * [[IMIDPHOSDEHYD-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GLUTAMIDOTRANS-RXN]] |
| − | * [[RXN- | + | * [[RXN-17900]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-erythro-imidazole-glycerol-phosphate}} |
| + | {{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}} | ||
| + | {{#set: molecular-weight=236.121}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P
- common-name:
- d-erythro-imidazole-glycerol-phosphate
- smiles:
- c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
- inchi-key:
- hfybthcypkedqq-ritpcoansa-l
- molecular-weight:
- 236.121
