Difference between revisions of "CPD1F-133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Feruloyl-polysaccharides == * common-name: ** a feruloyl-polysaccharide == Reaction(s) known to consume the compound == * [[3.1.1.73-RXN]...")
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Feruloyl-polysaccharides ==
+
== Metabolite CPD1F-133 ==
 
* common-name:
 
* common-name:
** a feruloyl-polysaccharide
+
** violaxanthin
 +
* smiles:
 +
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
 +
* inchi-key:
 +
** szcbxwmuopqsox-wvjdlnglsa-n
 +
* molecular-weight:
 +
** 600.88
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.1.73-RXN]]
+
* [[RXN-13185]]
 +
* [[RXN-7984]]
 +
* [[RXN1F-155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13185]]
 +
* [[RXN-7979]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a feruloyl-polysaccharide}}
+
{{#set: common-name=violaxanthin}}
 +
{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
 +
{{#set: molecular-weight=600.88}}

Revision as of 14:54, 5 January 2021

Metabolite CPD1F-133

  • common-name:
    • violaxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
  • inchi-key:
    • szcbxwmuopqsox-wvjdlnglsa-n
  • molecular-weight:
    • 600.88

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality