Difference between revisions of "CPD-1108"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLYCERALD == * common-name: ** d-glyceraldehyde * smiles: ** [ch](=o)c(o)co * inchi-key: ** mnqzxjomywmbou-vkhmyheasa-n * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLYCERALD ==
+
== Metabolite LL-DIAMINOPIMELATE ==
 
* common-name:
 
* common-name:
** d-glyceraldehyde
+
** l,l-diaminopimelate
 
* smiles:
 
* smiles:
** [ch](=o)c(o)co
+
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
 
* inchi-key:
 
* inchi-key:
** mnqzxjomywmbou-vkhmyheasa-n
+
** gmkmezvlhjarhf-whfbiakzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 90.079
+
** 190.199
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALCD19]]
+
* [[DIAMINOPIMEPIM-RXN]]
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN-7737]]
* [[RXN-15115]]
 
* [[TRIOKINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALCD19]]
+
* [[DIAMINOPIMEPIM-RXN]]
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN-7737]]
* [[RXN-15115]]
 
* [[RXN-8631]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glyceraldehyde}}
+
{{#set: common-name=l,l-diaminopimelate}}
{{#set: inchi-key=inchikey=mnqzxjomywmbou-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}}
{{#set: molecular-weight=90.079}}
+
{{#set: molecular-weight=190.199}}

Revision as of 14:54, 5 January 2021

Metabolite LL-DIAMINOPIMELATE

  • common-name:
    • l,l-diaminopimelate
  • smiles:
    • c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
  • inchi-key:
    • gmkmezvlhjarhf-whfbiakzsa-n
  • molecular-weight:
    • 190.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality