Difference between revisions of "PROGESTERONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11855 == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o * inchi-key: ** yrwamsx...")
(Created page with "Category:metabolite == Metabolite NICOTINE == * common-name: ** (s)-nicotine * smiles: ** c1(cc[ch]([n+](c)1)c2(c=nc=cc=2)) * inchi-key: ** snicxcgakadscv-jtqlqieisa-o * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11855 ==
+
== Metabolite NICOTINE ==
 
* common-name:
 
* common-name:
** (r)-4-hydroxy-4-methyl-2-oxoglutarate
+
** (s)-nicotine
 
* smiles:
 
* smiles:
** cc(o)(cc(c(=o)[o-])=o)c([o-])=o
+
** c1(cc[ch]([n+](c)1)c2(c=nc=cc=2))
 
* inchi-key:
 
* inchi-key:
** yrwamsxhybbhfl-zcfiwibfsa-l
+
** snicxcgakadscv-jtqlqieisa-o
 
* molecular-weight:
 
* molecular-weight:
** 174.11
+
** 163.242
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12074]]
+
* [[RXN66-146]]
 +
* [[RXN66-81]]
 +
* [[RXN66-83]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12074]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-4-hydroxy-4-methyl-2-oxoglutarate}}
+
{{#set: common-name=(s)-nicotine}}
{{#set: inchi-key=inchikey=yrwamsxhybbhfl-zcfiwibfsa-l}}
+
{{#set: inchi-key=inchikey=snicxcgakadscv-jtqlqieisa-o}}
{{#set: molecular-weight=174.11}}
+
{{#set: molecular-weight=163.242}}

Revision as of 14:54, 5 January 2021

Metabolite NICOTINE

  • common-name:
    • (s)-nicotine
  • smiles:
    • c1(cc[ch]([n+](c)1)c2(c=nc=cc=2))
  • inchi-key:
    • snicxcgakadscv-jtqlqieisa-o
  • molecular-weight:
    • 163.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality