Difference between revisions of "CPD-8678"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...")
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY ==
+
== Metabolite RH-Group ==
 
* common-name:
 
* common-name:
** prostaglandin f2α
+
** an organic molecule
* smiles:
 
** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
 
* inchi-key:
 
** pxgpltodnuvgfl-ynnpmvkqsa-m
 
* molecular-weight:
 
** 353.478
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.188-RXN]]
+
* [[RXN-12615]]
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.188-RXN]]
 
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prostaglandin f2α}}
+
{{#set: common-name=an organic molecule}}
{{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}}
 
{{#set: molecular-weight=353.478}}
 

Revision as of 14:54, 5 January 2021

Metabolite RH-Group

  • common-name:
    • an organic molecule

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality